| Identification | |
| Name: | 6-Methoxyguanine |
| Synonyms: | 6-methoxy-5H-purin-2-amine;Purine, 2-amino-6-methoxy-;1H-Purin-2-amine, 6-methoxy-;6-methoxy-7H-purin-2-amine;Purine, 2-amino-6-methoxy- (8CI);O-(6)-Methylguanine;6-Methoxy-1H-purine-2-amine;O(sup 6)-Methylguanine;2-Amino-6-methoxypurine;2-Amino-6-methoxy-9H-purine; |
| CAS: | 20535-83-5 |
| Molecular Formula: | C6H7N5O |
| Molecular Weight: | 165.15268 |
| InChI: | InChI=1S/C6H7N5O/c1-12-5-3-4(9-2-8-3)10-6(7)11-5/h2H,1H3,(H3,7,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | > 300C (Decomposes) |
| Density: | 1.531 g/cm3 |
| Refractive index: | 1.814 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble
Appearance:white
to off-white crystalline powder Hazard Symbols:Not regulated UN NO. |
| Appearance: | white to off-white crystalline powder |
| Specification: |
O-(6)-Methylguanine , its cas register number is 20535-83-5. It also can be called 2-Amino-6-methoxypurine ; 6-Methoxy-1H-purine-2-amine ; 6-Methoxyguanine ; NSC 37364 ; O(sup 6)-Methylguanine ; Purine, 2-amino-6-methoxy- ; 1H-Purin-2-amine, 6-methoxy- ; Purine, 2-amino-6-methoxy- (8CI) .It is a off-white solid. |
| Usage: | Antitumor agent |
| Safety Data | |
| Hazard Symbols | |
 |
|
