| Identification | |
| Name: | 1-Naphthalenamine,N-phenyl-, hydrobromide (1:1) |
| Synonyms: | 1-Naphthalenamine,N-phenyl-, hydrobromide (9CI) |
| CAS: | 205526-65-4 |
| Molecular Formula: | C16H13 N . Br H |
| Molecular Weight: | 219.2811 |
| InChI: | InChI=1/C16H13N.BrH/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16;/h1-12,17H;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 61 deg C |
| Flash Point: | 190.2°C |
| Boiling Point: | 370.7°Cat760mmHg |
| Density: | 1.156g/cm3 |
| Solubility: | Soluble in ethanol, ethyl ether, benzene, carbon tetrachloride, chloroform, acetic acid. In water, 60 mg/L @ 25 deg C |
| Flash Point: | 190.2°C |
| Color: | Prisms or needles from alcohol; leaflets from ligroin. Tan to purple crushed solid or crystals. White to yellowish crystals In its pure form crystallizes into lemon yellow prisms or needles ... marketed in the form of brown to dark violet crystals or light brown to light violet granules |
| Safety Data | |
 |
|
