| Identification | |
| Name: | Pyridine,4-(3-phenylpropyl)- |
| Synonyms: | 1-(4-Pyridyl)-3-phenylpropane;4-Phenylpropylpyridine; |
| CAS: | 2057-49-0 |
| EINECS: | 218-159-1 |
| Molecular Formula: | C14H15N |
| Molecular Weight: | 197.28 |
| InChI: | InChI=1/C14H15N/c1-2-5-13(6-3-1)7-4-8-14-9-11-15-12-10-14/h1-3,5-6,9-12H,4,7-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.03 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.563 |
| Water Solubility: | 0.1% (25ºC) in water |
| Solubility: | 0.1% (25ºC) in water |
| Appearance: | yellow to brown clear liquid. |
| Specification: |
4-(3-Phenylpropyl)pyridine (CAS NO.2057-49-0), its Synonyms are Pyridine, 4-(3-phenylpropyl)- ; 1-(4-Pyridyl)-3-phenylpropane ; 4-Phenylpropylpyridine ; 4-(3-phenylpropyl)-pyridin . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
