| Identification | |
| Name: | Benz[a]anthracene,6,8,12-trimethyl- |
| Synonyms: | 6,8,12-Trimethylbenz[a]anthracene |
| CAS: | 20627-34-3 |
| Molecular Formula: | C21H18 |
| Molecular Weight: | 270.39 |
| InChI: | InChI=1/C21H18/c1-13-7-6-10-17-15(3)21-18-9-5-4-8-16(18)11-14(2)20(21)12-19(13)17/h4-12H,1-3H3 |
| Molecular Structure: | ![(C21H18) 6,8,12-Trimethylbenz[a]anthracene](https://img1.guidechem.com/chem/e/dict/66/20627-34-3.jpg) |
| Properties | |
| Flash Point: | 236.8°C |
| Boiling Point: | 477.5°Cat760mmHg |
| Density: | 1.123g/cm3 |
| Refractive index: | 1.712 |
| Specification: |
6,8,12-Trimethylbenz(a)anthracene , its cas register number is 20627-34-3. It also can be called BRN 1970612 . When heated to decomposition it emits acrid smoke and irritating fumes. |
| Flash Point: | 236.8°C |
| Safety Data | |
 |
|
