| Identification | |
| Name: | N-Chloroacetyl-3,5-diethyl-4-aminophenol |
| Synonyms: | N-Chloroacetyl-3,5-diethyl-4-aminophenol;2-Chloro-N-(2,6-diethyl-4-hydroxyphenyl)acetamide;Acetamide, 2-chloro-N-(2,6-diethyl-4-hydroxyphenyl)-;AC1MIP6D;LS-8481;206439-02-3 |
| CAS: | 206439-02-3 |
| Molecular Formula: | C12H16ClNO2 |
| Molecular Weight: | 241.7139 |
| InChI: | InChI=1/C12H16ClNO2/c1-3-8-5-10(15)6-9(4-2)12(8)14-11(16)7-13/h5-6,15H,3-4,7H2,1-2H3,(H,14,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 219.3°C |
| Boiling Point: | 439°C at 760 mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.585 |
| Specification: |
N-Chloroacetyl-3,5-diethyl-4-aminophenol , its cas register number is 206439-02-3. It also can be called 2-Chloro-N-(2,6-diethyl-4-hydroxyphenyl)acetamide .When N-Chloroacetyl-3,5-diethyl-4-aminophenol (CAS NO.206439-02-3) is heated to decomposition, it emits toxic vapors of NOx and Cl−. |
| Flash Point: | 219.3°C |
| Safety Data | |
 |
|
