| Identification | |
| Name: | 5-Bromovaleric acid |
| Synonyms: | 5-Bromovaleric acid, (5-Bromopentanoic acid); 5-Bromopentanoic acid; 5_bromovaleric acid |
| CAS: | 2067-33-6 |
| EINECS: | 218-185-3 |
| Molecular Formula: | C5H9BrO2 |
| Molecular Weight: | 181.03 |
| InChI: | InChI=1/C5H9BrO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3261 |
| Density: | 1.522 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | slightly yellow solid |
| Specification: |
5-Bromovaleric acid (CAS NO.2067-33-6), its Synonyms are 5-Bromopentanoic acid ; Valeric acid, 5-bromo- ; delta-Bromovaleric acid ; Pentanoic acid, 5-bromo- . It is yellowish to light brown crystals or cryst. powder. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
