| Identification | |
| Name: | 3-Hydroxyisobutyric acid |
| CAS: | 2068-83-9 |
| Molecular Formula: | C4H8O3 |
| Molecular Weight: | 104.1045 |
| InChI: | InChI=1S/C4H8O3/c1-3(2-5)4(6)7/h3,5H,2H2,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 121°C |
| Boiling Point: | 252.9°Cat760mmHg |
| Density: | 1.195g/cm3 |
| Flash Point: | 121°C |
| Usage: |
3-Hydroxyisobutyric acid (CAS NO.2068-83-9) is used as a metabolite of 3-Hydroxyisobutyrate dehydrogenase and an intermediate in the metabolism of valine. |
| Safety Data | |
 |
|
