| Identification | |
| Name: | Benzenamine,4-iodo-2-nitro- |
| Synonyms: | Aniline,4-iodo-2-nitro- (7CI,8CI); 4-Iodo-2-nitroaniline |
| CAS: | 20691-72-9 |
| Molecular Formula: | C6H5 I N2 O2 |
| Molecular Weight: | 264.02 |
| InChI: | InChI=1/C6H5IN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 167.2°C |
| Boiling Point: | 352.9°C at 760 mmHg |
| Density: | 2.101g/cm3 |
| Refractive index: | 1.726 |
| Specification: |
4-Iodo-2-nitroaniline , its cas register number is 20691-72-9. It also can be called Benzenamine, 4-iodo-2-nitro- . 4-Iodo-2-nitroaniline (CAS NO.20691-72-9) is harmful if swallowed. And it may cause sensitization by skin contact. |
| Flash Point: | 167.2°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
