| Identification | |
| Name: | Benzoic acid,3-[2-[4-(dimethylamino)phenyl]diazenyl]- |
| Synonyms: | Benzoicacid, 3-[[4-(dimethylamino)phenyl]azo]- (9CI); Benzoic acid,m-[[p-(dimethylamino)phenyl]azo]- (6CI,7CI,8CI);3-[4-(Dimethylamino)phenylazo]benzoic acid;3'-Carboxy-4-dimethylaminoazobenzene; m-Methyl red |
| CAS: | 20691-84-3 |
| Molecular Formula: | C15H15 N3 O2 |
| Molecular Weight: | 269.3 |
| InChI: | InChI=1/C15H15N3O2/c1-18(2)14-8-6-12(7-9-14)16-17-13-5-3-4-11(10-13)15(19)20/h3-10H,1-2H3,(H,19,20)/b17-16+ |
| Molecular Structure: | ![(C15H15N3O2) Benzoicacid, 3-[[4-(dimethylamino)phenyl]azo]- (9CI); Benzoic acid,m-[[p-(dimethylamino)phenyl]azo]-...](https://img.guidechem.com/casimg/20691-84-3.gif) |
| Properties | |
| Flash Point: | 247.8°C |
| Boiling Point: | 486.2°C at 760 mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
M-Methyl Red (CAS NO.20691-84-3) is an azo dye, and is a dark red crystalline powder.It is a pH indicator; it is red in pH under 4.4, yellow in pH over 6.2, and orange in between, with a pKa of 5.1. |
| Flash Point: | 247.8°C |
| Safety Data | |
 |
|
