| Identification | |
| Name: | 2-Propoxyethyl acetate |
| Synonyms: | ethylene glycol monopropyl ether acetate;ETHYLENEGLYCOLPROPYLETHERACETATE;2-PROPOXYETHYLACETATE;ETHYLENEGLYCOL(MONO)N-PROPYLETHERACETATE;(2-Propyloxy) Ethylacetate;Acetic acid 2-propoxyethyl ester |
| CAS: | 20706-25-6 |
| Molecular Formula: | C7H14O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C7H14O3/c1-3-4-9-5-6-10-7(2)8/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1992 |
| Specification: |
2-Propoxyethyl acetate ,its cas register number is 20706-25-6. It also can be called Acetic acid, 2-propoxyethyl ester ; and Ethanol, 2-propoxy-, acetate . |
| Report: |
Glycol ether compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| Safety Data | |
 |
|
