| Identification | |
| Name: | Benzoic acid,2-amino-4,5-difluoro-, methyl ester |
| Synonyms: | 2-Amino-4,5-difluorobenzoicacid methyl ester;Methyl 2-amino-4,5-difluorobenzoate; |
| CAS: | 207346-42-7 |
| Molecular Formula: | C8H7F2NO2 |
| Molecular Weight: | 187.14 |
| InChI: | InChI=1/C8H7F2NO2/c1-13-8(12)4-2-5(9)6(10)3-7(4)11/h2-3H,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.355 g/cm3 |
| Refractive index: | 1.524 |
| Appearance: | light yellow crystalline |
| Specification: |
The IUPAC name of Methyl 2-amino-4,5-difluorobenzoate is methyl 2-amino-4,5-difluorobenzoate. With the CAS registry number 207346-42-7, it is also named as Benzoic acid, 2-amino-4,5-difluoro-, methyl ester. The product's categories are Aminoacid; Phenylacetic acid; Esters; Phenyls & Phenyl-Het. Besides, it is light yellow crystalline. In addition, its molecular formula is C8H7F2NO2 and molecular weight is 187.14. The other characteristics of Methyl 2-amino-4,5-difluorobenzoate can be summarized as: (1)ACD/LogP: 2.84; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.84; (4)ACD/LogD (pH 7.4): 2.84; (5)ACD/BCF (pH 5.5): 85.3; (6)ACD/BCF (pH 7.4): 85.3; (7)ACD/KOC (pH 5.5): 839; (8)ACD/KOC (pH 7.4): 839.05; (9)H bond acceptors: 3; (10)H bond donors: 2; (11)Freely Rotating Bonds: 3; (12)Polar Surface Area: 52.32 Å2; (13)Index of Refraction: 1.524; (14)Molar Refractivity: 42.24 cm3; (15)Molar Volume: 138 cm3; (16)Polarizability: 16.74×10-24cm3; (17)Surface Tension: 42.3 dyne/cm; (18)Density: 1.355 g/cm3; (19)Flash Point: 119.5 °C; (20)Enthalpy of Vaporization: 51.24 kJ/mol; (21)Boiling Point: 274.1 °C at 760 mmHg; (22)Vapour Pressure: 0.00553 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
