| Identification | |
| Name: | (S)-Styrene oxide |
| Synonyms: | (S)-(+)-Epoxyethylbenzene;(S)-(-)-Styrene oxide;(S) 2-Phenyl ethylene oxide;Benzene, (epoxyethyl)-, (S)-;S-(Epoxyethyl)benzene;(S)-(+)-Styrene oxide;(2S)-2-phenyloxirane;S-Phenyloxirane;(S)-Styrene 0xide; |
| CAS: | 20780-54-5 |
| Molecular Formula: | C8H8O |
| Molecular Weight: | 120.15 |
| InChI: | InChI=1/C8H8O/c1-2-4-7(5-3-1)8-6-9-8/h1-5,8H,6H2/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Flash Point: | 175? |
| Density: | 1.051 |
| Refractive index: | 1.535 |
| Alpha: | -33 º (NEAT) |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
(S)-Styrene oxide (CAS NO.20780-54-5) is a colorless to light yellow liquid. |
| Flash Point: | 175? |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
