| Identification | |
| Name: | Acenaphthylene |
| Synonyms: | Cyclopenta[de]naphthalene;NSC 59821; acenaphthyene |
| CAS: | 208-96-8 |
| EINECS: | 205-917-1 |
| Molecular Formula: | C12H8 |
| Molecular Weight: | 152.19 |
| InChI: | InChI=1/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H |
| Molecular Structure: | ![(C12H8) Cyclopenta[de]naphthalene;NSC 59821; acenaphthyene](https://img.guidechem.com/casimg/208-96-8.gif) |
| Properties | |
| Transport: | UN 3077 |
| Density: | 0.899 |
| Stability: | Stable. Incompatible with oxidizing agents. |
| Refractive index: | 1.731 |
| Water Solubility: | 16.1 mg/liter in water |
| Solubility: | 16.1 mg/liter in water |
| Appearance: | yellow flakes |
| Specification: | yellow crystalline powder Safety Statements:26-36/37/39-62-61-60-45-36/37-16-7-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label 61:Avoid release to the environment. Refer to special instructions safety data sheet 60:This material and/or its container must be disposed of as hazardous waste 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 16:Keep away from sources of ignition - No smoking 7:Keep container tightly closed 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | APPROX 4°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
