| Identification | |
| Name: | 2-Pentanethiol |
| Synonyms: | 1-Methylbutanethiol;2-Pentyl mercaptan; sec-Amylmercaptan |
| CAS: | 2084-19-7 |
| EINECS: | 218-224-4 |
| Molecular Formula: | C5H12 S |
| Molecular Weight: | 104.21 |
| InChI: | InChI=1/C5H12S/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Melting Point: | -169ºC |
| Density: | 0.83 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | n20/D 1.4410(lit.) |
| Water Solubility: | slightly soluble in water; soluble in alcohol |
| Solubility: | slightly soluble in water; soluble in alcohol |
| Appearance: | colourless liquid |
| Specification: |
2-Pentanethiol , its CAS NO. is 2084-19-7, the synonyms are 1-Methylbutanethiol ; 2-Mercaptopentane ; Amyl mercaptan, sec- ; EINECS 218-224-4 ; FEMA No. 3792 ; Pentane-2-thiol . |
| Packinggroup: | II |
| Storage Temperature: | Keep container closed. Keep away from heat, sparks, and open flame. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
