| Identification |
| Name: | 1-Methyl-2-piperidinemethanol |
| Synonyms: | 1-Methylpiperidine-2-methanol; 2-Hydroxymethyl-1-methylpiperidine; N-Methylpiperidine-2-carbinol; 2-HYDROXYMETHYL-N-METHYLPIPERIDINE; (1-Methyl-2-piperidinyl)methanol; 1-Methyl-2-hydroxymethylpiperidine; 2-Piperidinemethanol, 1-methyl- |
| CAS: | 20845-34-5 |
| EINECS: | 244-078-6 |
| Molecular Formula: | C7H15NO |
| Molecular Weight: | 129.2 |
| InChI: | InChI=1/C7H15NO/c1-8-5-3-2-4-7(8)6-9/h7,9H,2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN2735 |
| Melting Point: | -20 |
| Density: | 0.984 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4813-1.4833 |
| Water Solubility: | Miscible with water |
| Solubility: | Miscible with water |
| Appearance: | brown clear liquid |
| HS Code: | 29333999 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
