Identification |
Name: | Ethanol,2-[2-(acetyloxy)ethoxy]- |
Synonyms: | Diethyleneglycol, acetate (7CI); Diethylene glycol, monoacetate (8CI);2,2'-Oxybis(ethanol) monoacetate; 2-(2-Hydroxyethoxy)ethyl acetate |
CAS: | 2093-20-1 |
EINECS: | 218-250-6 |
Molecular Formula: | C6H12 O4 |
Molecular Weight: | 148.15708 |
InChI: | InChI=1/C6H12O4/c1-6(8)10-5-4-9-3-2-7/h7H,2-5H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 91.1°C |
Boiling Point: | 231°Cat760mmHg |
Density: | 1.098g/cm3 |
Stability: | No data available, but presumed to be stable, flammable and incompatible with strong oxidizing agents. |
Refractive index: | 1.43 |
Flash Point: | 91.1°C |
Safety Data |
|
 |