| Identification | |
| Name: | 1-Adamantanecarboxylic acid chloride |
| Synonyms: | Adamantane-1-carbonyl chloride; tricyclo(3.3.1.13,7)decane-1-carbonyl chloride |
| CAS: | 2094-72-6 |
| EINECS: | 218-252-7 |
| Molecular Formula: | C11H15ClO |
| Molecular Weight: | 198.69 |
| InChI: | InChI=1/C11H15ClO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.239 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.556 |
| Water Solubility: | may decompose |
| Solubility: | may decompose with water |
| Appearance: | white to almost white crystalline solid |
| Specification: |
1-Adamantanecarbonyl chloride , its cas register number is 2094-72-6. It also can be called Tricyclo(3.3.1.1'3,7)decane-1-carbonyl chloride ; Adamantoyl chloride .It is a white to almost white crystalline solid. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
