| Identification |
| Name: | Carbonic acid, thio-, anhydrosulfide with 4-bromo-3-methyldithiocarbanilic acid, ethyl ester |
| Synonyms: | Thiocarbonic acid anhydrosulfide with 4-bromo-3-methyldithiocarbanilic acid ethyl ester;Carbonic acid, thio-, anhydrosulfide with 4-bromo-3-methyldithiocarbanilic acid, ethyl ester;AC1MHUNE;LS-52107;ethyl (4-bromo-3-methylphenyl)carbamothioylsulfanylformate;20975-62-6 |
| CAS: | 20975-62-6 |
| Molecular Formula: | C11H12BrNO2S2 |
| Molecular Weight: | 334.25248 |
| InChI: | InChI=1/C11H12BrNO2S2/c1-3-15-11(14)17-10(16)13-8-4-5-9(12)7(2)6-8/h4-6H,3H2,1-2H3,(H,13,16) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 192.3°C |
| Boiling Point: | 394.3°C at 760 mmHg |
| Refractive index: | 1.666 |
| Flash Point: | 192.3°C |
| Safety Data |
| |
 |
