| Identification | |
| Name: | 2-(1-Piperazinyl)pyrimidine |
| Synonyms: | 1-(2-Pyrimidyl)piperazine;1-(4-Pyrimidin-2-yl)piperazine;1-PP;2-Piperazinopyrimidine;4-(2-Pyrimidinyl)piperazine;CM 56324H;MJ 13653;N-2-Pyrimidinylpiperazine; |
| CAS: | 20980-22-7 |
| EINECS: | 244-135-5 |
| Molecular Formula: | C8H12N4 |
| Molecular Weight: | 164.21 |
| InChI: | InChI=1/C8H12N4/c1-2-10-8(11-3-1)12-6-4-9-5-7-12/h1-3,9H,4-7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.079 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.585-1.588 |
| Solubility: | Very soluble |
| Appearance: | After melting, clear yellow. |
| Specification: |
?1-(2-Pyrimidinyl)piperazine , its CAS NO. is 20980-22-7, the synonyms are 1-(2-Pyrimidyl)piperazine dihydrochloride ; 1-(2-Pyrimidyl)piperazine ; 2-Piperazinopyrimidine . |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
