| Identification | |
| Name: | (S)-(+)-2-Phenylglycinol |
| Synonyms: | S(+)-2-phenylglycinol;Benzeneethanol, beta-amino-, (S)-;(2S)-2-amino-2-phenyl-ethanol;L-phenylglycinol;(S)-(+)-2-Amino-2-phenylethanol;L-(+)-alpha-Phenylglycinol;L-2-Phenylglycinol;(S)-(+)-2-Pheny;(S)-(+)-Phenylglycinol;(S)-(-)-2-Phenylalanine;(S)-2-Phenylglycinol;L-(+)-2-Phenylglycinol;(S)-Phenylglycinol;(S)-2-Phenylglycinol hydrochloride; |
| CAS: | 20989-17-7 |
| EINECS: | 260-287-5 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.104g/cm3 |
| Alpha: | -25.5 o (C=6, MEOH) |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?(S)-(+)-2-Phenylglycinol , with CAS number of 20989-17-7, can be called (R)/(S)-Phenylglycinol ; 2-Amino-2-pheynlethanol ; Benzeneethanol, beta-amino-, (S)- ; (2S)-2-amino-2-phenyl-ethanol ; (S)-(+)-2-Amino-2-phenylethanol ; (S)-(+)-2-Pheny ; S-(+)-2-Phenylglycinol (>=99%) ; (S)-(-)-2-Phenylalanine ; L-(+)-2-Phenylglycinol ; (S)-(+)-2-Amino-2-Phenylethanol; (S)-(+)-2- . It is a?white to light yellow crystal powde. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
