| Identification |
| Name: | 2-Amino-3-methyl-3H-imidazo[4,5-F]quinoline-2-13C |
| Synonyms: | 3-Methyl-3H-imidazo[4,5-f]quinolin-2-amine-2-13C;IQ-2-13 |
| CAS: | 210049-11-9 |
| Molecular Formula: | C11H10N4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H10N4/c1-15-9-5-4-8-7(3-2-6-13-8)10(9)14-11(15)12/h2-6H,1H3,(H2,12,14)/i11+1 |
| Molecular Structure: |
![(C11H10N4) 3-Methyl-3H-imidazo[4,5-f]quinolin-2-amine-2-13C;IQ-2-13](https://img.guidechem.com/structure/210049-11-9.gif) |
| Properties |
| Density: | 1.413g/cm3 |
| Refractive index: | 1.754 |
| Usage: | IQ is highly mutagenic in the Ames test. Investigations have shown that this compound may be present in broiled fish, fried beef, commercial beef extracts and protein pyrolysates. |
| Safety Data |
| |
 |
