| Identification | |
| Name: | Benzene, 1,2,4-trifluoro-5-nitro |
| Synonyms: | 2,4,5-trifluoronitrobenzene; 1,2,4-Trifluoro-5-nitrobenzene |
| CAS: | 2105-61-5 |
| EINECS: | 218-281-5 |
| Molecular Formula: | C6H2F3NO2 |
| Molecular Weight: | 177.08 |
| InChI: | InChI=1/C6H2F3NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.544 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.493-1.495 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | clear to yellowish liquid |
| Specification: |
2,4,5-Trifluoronitrobenzene ,its cas register number is 2105-61-5. It also can be called 1,2,4-Trifluoro-5-nitrobenzene ; and 1,2,4-Trifluor-5-nitrobenzol . |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xi:Irritant
|
 |
|
