| Identification | |
| Name: | 5,6-Dimethoxy-1-indanone |
| Synonyms: | 5,6-Dimethoxyindan-1-one;5,6-dimethoxy-2,3-dihydroinden-1-one;2,3-Dihydro-5,6-dimethoxy-1H-inden-1-one;1H-Inden-1-one,2,3-dihydro-5,6-dimethoxy-;5,6-Dimethoxy Indanone;5,6-dimethoxy-1-indelene-1-one; |
| CAS: | 2107-69-9 |
| EINECS: | 218-287-8 |
| Molecular Formula: | C11H12O3 |
| Molecular Weight: | 192.21 |
| InChI: | InChI=1/C11H12O3/c1-13-10-5-7-3-4-9(12)8(7)6-11(10)14-2/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.179g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.615 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
? 5,6-Dimethoxyindan-1-one?with cas registry number of 2107-69-9 is?white to light yellow crystal powder, also called?NSC 401450 ; 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy- . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
