| Identification | |
| Name: | Benz[l]aceanthrylene(8CI,9CI) |
| Synonyms: | benz(l)aceanthrylene;BENZO(L)ACEANTHRYLENE |
| CAS: | 211-91-6 |
| Molecular Formula: | C20H12 |
| Molecular Weight: | 252.32 |
| InChI: | InChI=1/C20H12/c1-2-7-17-13(4-1)8-9-16-12-15-6-3-5-14-10-11-18(19(14)15)20(16)17/h1-12H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 247.1°C |
| Boiling Point: | 498.5°C at 760 mmHg |
| Density: | 1.284g/cm3 |
| Refractive index: | 1.839 |
| Specification: |
Removal in wastewater treatment of Benz(1)aceanthrylene (CAS No.211-91-6) can be stated as follows: |
| Flash Point: | 247.1°C |
| Safety Data | |
 |
|
