| Identification | |
| Name: | Imidodicarbonimidicdiamide, N-(3-chlorophenyl)-, hydrochloride (1:1) |
| Synonyms: | Biguanide,1-(m-chlorophenyl)-, monohydrochloride (8CI); Imidodicarbonimidic diamide,N-(3-chlorophenyl)-, monohydrochloride (9CI); N-m-Chlorophenylbiguanidehydrochloride |
| CAS: | 2113-05-5 |
| Molecular Formula: | C8H10 Cl N5 . Cl H |
| Molecular Weight: | 211.65 |
| InChI: | InChI=1/C8H10ClN5.ClH/c9-5-2-1-3-6(4-5)13-8(12)14-7(10)11;/h1-4H,(H6,10,11,12,13,14);1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 190-194 °C(lit.) |
| Flash Point: | 216.3°C |
| Boiling Point: | 434.1°Cat760mmHg |
| Density: | 1.49g/cm3 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Prototypical potent and selective 5-HT 3 receptor agonist. |
| Flash Point: | 216.3°C |
| Storage Temperature: | Desiccate at RT |
| Sensitive: | Hygroscopic |
| Color: | white |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
