| Identification | |
| Name: | Isoxazole-5-carboxylic acid |
| Synonyms: | 5-Isoxazolecarboxylic acid;oxazole-5-carboxylate; |
| CAS: | 21169-71-1 |
| Molecular Formula: | C4H3NO3 |
| Molecular Weight: | 113.07 |
| InChI: | InChI=1/C4H3NO3/c6-4(7)3-1-2-5-8-3/h1-2H,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148.1ºC |
| Boiling Point: | 321.2 ºC at 760 mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.516 |
| Appearance: | slightly yellow powder |
| Specification: |
Isoxazole-5-carboxylic acid (21169-71-1) is slightly yellow powder, also named as 1,2-oxazole-5-carboxylic acid ; 5-Isoxazolecarboxylic acid ; Isoxazole-5-carboxylic acid 98% ; Isoxazole-5-carboxylic acid , 98% . It is incompatible with reducing agents, bases. When heated to decomposition, it yields Nitrogen oxides, Carbon monoxide , Carbon dioxide . |
| Flash Point: | 148.1ºC |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
