Identification |
Name: | Benzoic acid,4-(dimethylamino)-, 2-ethylhexyl ester |
Synonyms: | Benzoicacid, p-(dimethylamino)-, 2-ethylhexyl ester (8CI);2-Ethylhexyl4-(N,N-dimethylamino)benzoate;2-Ethylhexyl N,N-dimethyl-p-aminobenzoate;2-Ethylhexyl p-(dimethylamino)benzoate;4-(Dimethylamino)benzoic acid 2-ethylhexyl ester;Arlatone UVB;EHDAB;EsacureEHA;Escalol 507;Eusolex 6007;Octyl dimethyl PABA;QuantacureEHA; |
CAS: | 21245-02-3 |
EINECS: | 244-289-3 |
Molecular Formula: | C17H27NO2 |
Molecular Weight: | 277.4 |
InChI: | InChI=1/C17H27NO2/c1-5-7-8-14(6-2)13-20-17(19)15-9-11-16(12-10-15)18(3)4/h9-12,14H,5-8,13H2,1-4H3 |
Molecular Structure: |
|
Properties |
Transport: | 20kgs |
Density: | 0.995 |
Refractive index: | 1.542 |
Solubility: | Soluble in alcohol, HCl, and KOH solutions; sparingly soluble in ether. Practically insoluble in acetic acid. In water, 5.3X10-3 mg/liter @ 25 deg C /Estimated/ |
Appearance: | Clear to slightly yellow liquid |
Color: | Crystals from water |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|