| Identification | |
| Name: | Boronic acid,B-(2,3,5-trichlorophenyl)- |
| Synonyms: | Boronicacid, (2,3,5-trichlorophenyl)- (9CI);2,3,5-Trichlorobenzeneboronic acid; |
| CAS: | 212779-19-6 |
| EINECS: | -0 |
| Molecular Formula: | C6H4BCl3O2 |
| Molecular Weight: | 225.26 |
| InChI: | InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 245°C |
| Flash Point: | 185.7°C |
| Boiling Point: | 383.4°Cat760mmHg |
| Density: | 1.6g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
2,3,5-Trichlorophenylboronic acid , its cas register number is 212779-19-6. It also can be called 2,3,5-Trichlorobenzeneboronic acid ; and Boronic acid, B-(2,3,5-trichlorophenyl)- . |
| Flash Point: | 185.7°C |
| Safety Data | |
 |
|
