| Identification | |
| Name: | Butanoic acid, 3-oxo-,2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl ester |
| Synonyms: | Acetoaceticacid, 2-hydroxyethyl ester methacrylate (8CI);Butanoic acid, 3-oxo-, 2-[(2-methyl-1-oxo-2-propenyl)oxy]ethylester (9CI);2-(Acetoacetoxy)ethyl methacrylate;2-(Methacryloyloxy)ethylacetoacetate;2-Hydroxyethyl methacrylate acetoacetate;AAEM;Eastman AAEM;Ethylene glycol acetoacetate methacrylate;Lonzamon AAEMA;2-(Methacryloyloxy)ethyl Acetoacetate; |
| CAS: | 21282-97-3 |
| EINECS: | 244-311-1 |
| Molecular Formula: | C10H14O5 |
| Molecular Weight: | 214.21516 |
| InChI: | InChI=1S/C10H14O5/c1-7(2)10(13)15-5-4-14-9(12)6-8(3)11/h1,4-6H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6 |
| Flash Point: | 113 ºC |
| Density: | 1.122 |
| Refractive index: | 1.456 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | yellowish Clear liquid. |
| Specification: | Clear liquid. usageEng:LONZAMON(R) AAEMA is a special methacrylic ester monomer with a reactive methylene group. It is suitable as comonomer for adhesives and coatings as well as copolymer for emulsion polymerisation. Safety Statements:26-36/37-45-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing |
| Flash Point: | 113 ºC |
| Usage: | LONZAMON(R) AAEMA is a special methacrylic ester monomer with a reactive methylene group. It is suitable as comonomer for adhesives and coatings as well as copolymer for emulsion polymerisation. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
