Identification |
Name: | Benzoic acid,2-chloro-4-[[2-[[(1R)-1-(hydroxymethyl)-2-methylpropyl]amino]-9-(1-methylethyl)-9H-purin-6-yl]amino]- |
Synonyms: | NG 95;Purvalanol B |
CAS: | 212844-54-7 |
Molecular Formula: | C20H25 Cl N6 O3 |
Molecular Weight: | 432.9039 |
InChI: | InChI=1/C20H25ClN6O3/c1-10(2)15(8-28)24-20-25-17(16-18(26-20)27(9-22-16)11(3)4)23-12-5-6-13(19(29)30)14(21)7-12/h5-7,9-11,15,28H,8H2,1-4H3,(H,29,30)(H2,23,24,25,26)/t15-/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 353.3°C |
Boiling Point: | 660.6°Cat760mmHg |
Density: | 1.43g/cm3 |
Refractive index: | 1.672 |
Biological Activity: | Cyclin-dependent kinase inhibitor. IC 50 values are 6, 6, 9, > 10,000, and 6 nM for cdc2/cyclin B, cdk2/cyclin A, cdk2/cyclin E, cdk4/cyclin D1 and cdk5-p35 respectively. Selective over a range of other protein kinases (IC 50 > 10,000 nM). Shown to have antiproliferative properties, mediated by p42/p44 MAPK. |
Flash Point: | 353.3°C |
Storage Temperature: | −20°C |
Safety Data |
|
|