| Identification |
| Name: | stearic acid, compound with 2-aminoethanol (1:1) |
| Synonyms: | Octadecanoic acid, compd. with 2-aminoethanol (1:1);Stearic acid, compound with 2-aminoethanol (1:1);octadecanoic acid - 2-aminoethanol (1:1) |
| CAS: | 2129-99-9 |
| EINECS: | 218-347-3 |
| Molecular Formula: | C20H43NO3 |
| Molecular Weight: | 345.5603 |
| InChI: | InChI=1/C18H36O2.C2H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3-1-2-4/h2-17H2,1H3,(H,19,20);4H,1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data |
| |
 |
