| Identification | |
| Name: | Methyl L-prolinate hydrochloride |
| CAS: | 2133-40-6 |
| EINECS: | 218-363-0 |
| Molecular Formula: | C6H12ClNO2 |
| Molecular Weight: | 129.15704 |
| InChI: | InChI=1S/C6H11NO2/c1-9-6(8)5-3-2-4-7-5/h5,7H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 56.5oC |
| Boiling Point: | 169.9 oC at 760 mmHg |
| Density: | 1.055g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -33 o (C=1, H2O) |
| Water Solubility: | 50 MG/ML (5%), H2O; CLEAR, COLORLESS SOLUTION |
| Solubility: | 50 MG/ML (5%), H2O; CLEAR, COLORLESS SOLUTION |
| Appearance: | White to off-white microcrystalline powder |
| Specification: |
Conditions to Avoid: Incompatible materials, dust generation, excess HEAT, exposure to moist air or WATER. |
| Flash Point: | 56.5oC |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
