| Identification | |
| Name: | Ethanone,1-(2-iodophenyl)- |
| Synonyms: | NSC 46625;o-Iodoacetophenone;2-Acetylphenyl iodide;Acetophenone,2'-iodo- (6CI,7CI,8CI); |
| CAS: | 2142-70-3 |
| Molecular Formula: | C8H7IO |
| Molecular Weight: | 246.04 |
| InChI: | InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116°C |
| Boiling Point: | 268.2°Cat760mmHg |
| Density: | 1.72 |
| Refractive index: | 1.618 |
| Appearance: | clear yellow liquid |
| Specification: | Clear yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 116°C |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
