| Identification | |
| Name: | Benzonitrile,2-chloro-4-methyl- |
| Synonyms: | p-Tolunitrile,2-chloro- (6CI,8CI);2-Chloro-4-methylbenzonitrile;2-Chloro-p-tolunitrile;NSC263769; |
| CAS: | 21423-84-7 |
| Molecular Formula: | C8H6ClN |
| Molecular Weight: | 151.5929 |
| InChI: | InChI=1/C8H6ClN/c1-6-2-3-7(5-10)8(9)4-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.19 g/cm3 |
| Refractive index: | 1.553 |
| Specification: |
The 2-Chloro-4-methylbenzonitrile is an organic compound with the formula C8H6ClN. The IUPAC name of this chemical is 2-chloro-4-methylbenzonitrile. With the CAS registry number 21423-84-7, it is also named as benzonitrile, 2-chloro-4-methyl-. Physical properties about 2-Chloro-4-methylbenzonitrile are: (1)ACD/LogP: 2.68; (2)#H bond acceptors: 1; (3)Polar Surface Area: 23.79 Å2; (4)Index of Refraction: 1.553; (5)Molar Refractivity: 40.77 cm3; (6)Molar Volume: 127.3 cm3; (7)Polarizability: 16.16×10-24cm3; (8)Surface Tension: 44.2 dyne/cm; (9)Density: 1.19 g/cm3; (10)Flash Point: 119.3 °C; (11)Enthalpy of Vaporization: 50.78 kJ/mol; (12)Boiling Point: 269.7 °C at 760 mmHg; (13)Vapour Pressure: 0.00716 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
