| Identification | |
| Name: | Benzenamine,2,6-dimethyl-, hydrochloride (1:1) |
| Synonyms: | 2,6-Xylidine,hydrochloride (8CI); Benzenamine, 2,6-dimethyl-, hydrochloride (9CI);2,6-Dimethylaniline hydrochloride; 2,6-Dimethylbenzenamine hydrochloride |
| CAS: | 21436-98-6 |
| EINECS: | 244-388-1 |
| Molecular Formula: | C8H11 N . Cl H |
| Molecular Weight: | 157.64 |
| InChI: | InChI=1/C8H11N.ClH/c1-6-4-3-5-7(2)8(6)9;/h3-5H,9H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 11.2 DEG C |
| Flash Point: | 91.1°C |
| Boiling Point: | 217.9°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Water solubility of 8240 ppm at 25 deg C Very soluble in ethanol, ether Soluble in oxygenated and aromatic solvents. |
| Flash Point: | 91.1°C |
| Color: | Yellow liquid Colorless to reddish-yellow, clear liquid |
| Safety Data | |
 |
|
