Identification |
Name: | Benzoic acid,3,5-dimethoxy-, methyl ester |
Synonyms: | 3,5-Dimethoxybenzoicacid methyl ester;Methyl 3,5-bis(methyloxy)benzoate;NSC 65605; |
CAS: | 2150-37-0 |
EINECS: | 218-423-6 |
Molecular Formula: | C10H12O4 |
Molecular Weight: | 196.2 |
InChI: | InChI=1/C10H12O4/c1-12-8-4-7(10(11)14-3)5-9(6-8)13-2/h4-6H,1-3H3 |
Molecular Structure: |
|
Properties |
Transport: | 25kgs |
Density: | 1.119 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.497 |
Solubility: | Appearance:white to off-white crystalline powder Transport Information:25kgs Hazard Symbols:UN NO. Safety:S24/25
|
Appearance: | white to off-white crystalline powder |
Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
Safety Data |
Hazard Symbols |
|
|
|