| Identification |
| Name: | Methyl 3,5-dihydroxybenzoate |
| Synonyms: | 3,5-Dihydroxybenzoic acid methyl ester |
| CAS: | 2150-44-9 |
| EINECS: | 218-426-2 |
| Molecular Formula: | C8H8O4 |
| Molecular Weight: | 168.15 |
| InChI: | InChI=1/C8H8O4/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4,9-10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.354 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.587 |
| Appearance: | white to off-white crystalline powder |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
