Identification |
Name: | Methyl 3,5-dihydroxybenzoate |
Synonyms: | 3,5-Dihydroxybenzoic acid methyl ester |
CAS: | 2150-44-9 |
EINECS: | 218-426-2 |
Molecular Formula: | C8H8O4 |
Molecular Weight: | 168.15 |
InChI: | InChI=1/C8H8O4/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4,9-10H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Density: | 1.354 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.587 |
Appearance: | white to off-white crystalline powder |
Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |