| Identification | |
| Name: | 11H-Dibenz[b,e]azepine,6-(chloromethyl)- |
| Synonyms: | Morphanthridine,6-(chloromethyl)- (8CI);6-Chloromethylmorphanthridine; |
| CAS: | 21535-44-4 |
| Molecular Formula: | C15H12ClN |
| Molecular Weight: | 241.71 |
| InChI: | InChI=1/C15H12ClN/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)17-15/h1-8H,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 166.1 °C |
| Boiling Point: | 351 °Cat760mmHg |
| Density: | 1.19 g/cm3 |
| Refractive index: | 1.625 |
| Appearance: | Off-White Solid |
| Specification: |
The systematic name of 6-Chloromethylmorphanthridine is 6-(chloromethyl)-11H-dibenzo[b,e]azepine . With the CAS registry number 21535-44-4, it is also named as 11H-dibenz[b,e]azepine, 6-(chloromethyl)- ; 6-(Chloromethyl)-11H-dibenzo[b,e]azepine . In the presented stereoselective synthesis of mianserin 1, it can be started with 6-chloromethylmorphanthridine as a precursor for the introduction of chirality adjuvant. People can use the following data to convert to the molecule structure. SMILES: ClCC\2=N\c1ccccc1Cc3c/2cccc3; InChI: InChI=1/C15H12ClN/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)17-15/h1-8H,9-10H2. |
| Flash Point: | 166.1 °C |
| Safety Data | |
 |
|
