| Identification | |
| Name: | Cyclopentanemethanamine,2-amino- |
| Synonyms: | Cyclopentanemethylamine,2-amino- (6CI,8CI);1-(Aminomethyl)-2-aminocyclopentane;1-Amino-2-(aminomethyl)cyclopentane;2-(Aminomethyl)cyclopentylamine;2-Aminocyclopentanemethylamine;NSC 141555;2-amino-Cyclopentanemethanamine; |
| CAS: | 21544-02-5 |
| EINECS: | 244-434-0 |
| Molecular Formula: | C6H14N2 |
| Molecular Weight: | 114.18876 |
| InChI: | InChI=1/C6H14N2/c7-4-5-2-1-3-6(5)8/h5-6H,1-4,7-8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 68.6°C |
| Boiling Point: | 176.5°Cat760mmHg |
| Density: | 0.943g/cm3 |
| Refractive index: | 1.487 |
| Specification: |
The 2-Aminocyclopentanemethylamine with the cas number 21544-02-5 is also called Cyclopentanemethanamine,2-amino-. The IUPAC name is 2-(aminomethyl)cyclopentan-1-amine. Its EINECS registry number is 244-434-0. The molecular formula is C6H14N2. The properties of the chemical are: (1)ACD/LogP: -0.33; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -4.43; (4)ACD/LogD (pH 7.4): -4.41; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 2; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 6.48 Å2; (13)Index of Refraction: 1.487; (14)Molar Refractivity: 34.84 cm3; (15)Molar Volume: 121 cm3; (16)Polarizability: 13.81×10-24cm3; (17)Surface Tension: 39.5 dyne/cm; (18)Enthalpy of Vaporization: 41.28 kJ/mol; (19)Vapour Pressure: 1.09 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 68.6°C |
| Safety Data | |
 |
|
