| Identification | |
| Name: | 2-Propenoic acid,dodecyl ester |
| Synonyms: | Acrylicacid, dodecyl ester (6CI,7CI,8CI); Ageflex FA 12; Blemmer LA; Dodecyl acrylate;KU-LA; LA; Lauryl acrylate; Light Acrylate L-A; NK Ester LA; NSC 24177;Photomer 4812; SR 335; SR 498D; Sartomer 335; Viscoat LA; n-Dodecyl acrylate |
| CAS: | 2156-97-0 |
| EINECS: | 218-463-4 |
| Molecular Formula: | C15H28 O2 |
| Molecular Weight: | 240.38 |
| InChI: | InChI=1/C15H28O2/c1-3-5-6-7-8-9-10-11-12-13-14-17-15(16)4-2/h4H,2-3,5-14H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Melting Point: | 4 |
| Flash Point: | >110 oC |
| Density: | 0.884 |
| Refractive index: | 1.445 |
| Specification: |
2-Propenoic acid, dodecyl ester , its cas register number is 2156-97-0. It also can be called AI3-03198 ; Acrylic acid, dodecyl ester ; Dodecyl acrylate ; Lauryl acrylate ; NSC 24177 ; n-Dodecyl acrylate ; n-Lauryl acrylate . |
| Flash Point: | >110 oC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
 |
|
