| Identification | |
| Name: | Benzoic acid,2-amino-4,6-dimethoxy- |
| Synonyms: | Anthranilicacid, 4,6-dimethoxy- (8CI);2-Amino-4,6-dimethoxybenzoic acid;4,6-Dimethoxyanthranilic acid; |
| CAS: | 21577-57-1 |
| Molecular Formula: | C9H11NO4 |
| Molecular Weight: | 197.18794 |
| InChI: | InChI=1/C9H11NO4/c1-13-5-3-6(10)8(9(11)12)7(4-5)14-2/h3-4H,10H2,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.295 g/cm3 |
| Refractive index: | 1.582 |
| Specification: |
The 2-Amino-4,6-dimethoxybenzoic acid with the cas number 21577-57-1 is also called Benzoic acid,2-amino-4,6-dimethoxy-. Its molecular formula is C9H11NO4. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.52; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 19; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 4; (11)Polar Surface Area: 81.78 Å2; (12)Index of Refraction: 1.582; (13)Molar Refractivity: 50.776 cm3; (14)Molar Volume: 152.248 cm3; (15)Polarizability: 20.129×10-24cm3; (16)Surface Tension: 51.866 dyne/cm; (17)Enthalpy of Vaporization: 65.643 kJ/mol; (18)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
