Identification |
Name: | Propanedioic acid,2-propyl-, 1,3-diethyl ester |
Synonyms: | Malonicacid, propyl-, diethyl ester (6CI,7CI,8CI);Propanedioic acid, propyl-, diethylester (9CI);2-Propylmalonic acid diethyl ester;Diethyl 2-propylmalonate;Diethyl n-propylmalonate;NSC 53659;Propylmalonic aciddiethyl ester; |
CAS: | 2163-48-6 |
EINECS: | 218-492-2 |
Molecular Formula: | C10H18O4 |
Molecular Weight: | 202.25 |
InChI: | InChI=1/C10H18O4/c1-4-7-8(9(11)13-5-2)10(12)14-6-3/h8H,4-7H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Density: | 0.987 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.418-1.42 |
Solubility: | Insoluble |
Appearance: | CLEAR COLOURLESS LIQUID |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
|
 |