| Identification | |
| Name: | lenacil |
| Synonyms: | 3-cyclohexyl-6,7-dihydro-1H-cyclopentapyrimidine-2,4-(3H,5H)-dione; 3-cycolhexyl-1,5,6,7-treahydrocyclo-pentapyrimidine-2,4(3H)-dione |
| CAS: | 2164-08-1 |
| EINECS: | 218-499-0 |
| Molecular Formula: | C13H18N2O2 |
| Molecular Weight: | 234.3 |
| InChI: | InChI=1/C13H18N2O2/c16-12-10-7-4-8-11(10)14-13(17)15(12)9-5-2-1-3-6-9/h9H,1-8H2,(H,14,17) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Flash Point: | 202.4°C |
| Boiling Point: | 411°Cat760mmHg |
| Density: | 1.32 |
| Refractive index: | 1.584 |
| Appearance: | Colorless crystals |
| Specification: |
Lenacil (2164-08-1) is also known as Lenacil [ANSI:BSI:ISO] ; 1H-Cyclopentapyrimidine-2,4(3H,5H)-dione, 3-cyclohexyl-6,7-dihydro-(7CI)(8CI)(9CI) ; 3-Cyclohexyl-1,5,6,7-tetrahydrocyclopentapyrimidine-2,4(3H)-dione ; 3-Cyclohexyl-5,6-trimethyleneuracil ; 3-Cyclohexyl-5,6-trimethylenuracil ; 3-Cyclohexyl-5,6-trimethylenuracil [German] ; 3-Cyclohexyl-6,7-dihydro-1H-cyclopentapyrimidine-2,4(3H,5H)-dione ; 5-24-07-00375 (Beilstein Handbook Reference) ; 6,7-Dihydro-3-cyclohexyl-1H-cyclopentapyrimidine-2,4(3H,5H)-dione ; Adol ; Adol (pesticide) ; Buracyl ; CCRIS 1936 ; Caswell No. 525A ; Du Pont 634 ; EPA Pesticide Chemical Code 525200 ; Elbatan ; Experimental herbicide 634 ; Herbicide 634 ; Hexilure ; Lenacile ; Lenacile [ISO-French] ; Uracil 634 ; Venzar ; 1H-Cyclopentapyrimidine-2,4(3H,5H)-dione, 3-cyclohexyl-6,7-dihydro- ; 1H-Cyclopentapyrimidine-2,4(3H,5H)-dione, 6,7-dihydro-3-cyclohexyl- . It is used to deal with mixed soil and bud for control in fodder radish, red radish and beet in the weeds. |
| Flash Point: | 202.4°C |
| Storage Temperature: | 0-6°C |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
 |
|
