| Identification |
| Name: | Triphenylene |
| Synonyms: | 1,2,3,4-Dibenznaphthalene;9,10-Benzophenanthrene;9,10-Benzphenanthrene;Benzo[l]phenanthrene;Isochrysene;NSC 57455; |
| CAS: | 217-59-4 |
| EINECS: | 205-922-9 |
| Molecular Formula: | C18H12 |
| Molecular Weight: | 228.29 |
| InChI: | InChI=1/C18H12/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18/h1-12H |
| Molecular Structure: |
![(C18H12) 1,2,3,4-Dibenznaphthalene;9,10-Benzophenanthrene;9,10-Benzphenanthrene;Benzo[l]phenanthrene;Isochrys...](https://img.guidechem.com/casimg/217-59-4.gif) |
| Properties |
| Transport: | UN 3077 9/PG 3 |
| Density: | 1.19 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.771 |
| Solubility: | Insoluble |
| Appearance: | very slightly beige |
| Packinggroup: | II; III |
| Storage Temperature: | 2-8°C |
| Usage: | Material for optical and electronic devices. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
| |
 |
