| Identification | |
| Name: | o-(1,3-Dithiolan-2-yl)phenyl dimethylcarbamate |
| Synonyms: | C-13963;Dimethylcarbamic acid 2-(1,3-dithiolan-2-yl)phenyl ester |
| CAS: | 21709-44-4 |
| Molecular Formula: | C12H15NO2S2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H15NO2S2/c1-13(2)12(14)15-10-6-4-3-5-9(10)11-16-7-8-17-11/h3-6,11H,7-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 192.3°C |
| Boiling Point: | 394.3°C at 760 mmHg |
| Density: | 1.263g/cm3 |
| Refractive index: | 1.613 |
| Specification: |
o-(1,3-Dithiolan-2-yl)phenyl dimethylcarbamate , its cas register number is 21709-44-4. It also can be called BRN 1319006 ; Carbamic acid, dimethyl-, O-(1,3-dithiolan-2-yl)phenyl ester ; and Carbamic acid, dimethyl-, 2-(1,3-dithiolan-2-yl)phenyl ester (9CI) . |
| Flash Point: | 192.3°C |
| Safety Data | |
 |
|
