| Identification |
| Name: | 2-(5-hydroxy-1H-indol-3-yl)ethanaminium 3-carboxypropanoate |
| Synonyms: | Serotonin succinate;3-(2-Aminoethyl)indol-5-ol, succinate;INDOL-5-OL, 3-(2-AMINOETHYL)-, SUCCINATE;Succinic acid, compd. with 3-(2-aminoethyl)indol-5-ol (1:1);AC1L1K8P;LS-83663;2-(5-hydroxy-1H-indol-3-yl)ethylazanium; 4-hydroxy-4-oxobutanoate;Butanedioic acid, compd. with 3-(2-aminoethyl)-1H-indol-5-ol (1:1);Butanedioic acid, compd. with 3-(2-aminoethyl)-1H-indol-5-ol (1:1) (8CI);21716-89-2 |
| CAS: | 21716-89-2 |
| Molecular Formula: | C14H18N2O5 |
| Molecular Weight: | 294.3031 |
| InChI: | InChI=1/C10H12N2O.C4H6O4/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;5-3(6)1-2-4(7)8/h1-2,5-6,12-13H,3-4,11H2;1-2H2,(H,5,6)(H,7,8) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 205.4°C |
| Boiling Point: | 416.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 205.4°C |
| Safety Data |
| |
 |
