| Identification | |
| Name: | Benzeneacetonitrile,2,3,4,5,6-pentachloro-a-hydroxy- |
| Synonyms: | Mandelonitrile,2,3,4,5,6-pentachloro- (8CI); (Pentachlorophenyl)glycolonitrile;2,3,4,5,6-Pentachloromandelonitrile; Oryzon; PCMN; Pentachloromandelonitrile |
| CAS: | 21727-09-3 |
| Molecular Formula: | C8H2 Cl5 N O |
| Molecular Weight: | 305.36 |
| InChI: | InChI=1/C8H2Cl5NO/c9-4-3(2(15)1-14)5(10)7(12)8(13)6(4)11/h2,15H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 206.3°C |
| Boiling Point: | 417.5°Cat760mmHg |
| Density: | 1.758g/cm3 |
| Refractive index: | 1.629 |
| Specification: |
Pentachloromandelonitrile with cas registry number of 21727-09-3 is called for (Pentachlorophenyl)glycolonitrile ; Oryzon ; PCMN ; Benzeneacetonitrile, 2,3,4,5,6-pentachloro-alpha-hydroxy- (9CI) ; Mandelonitrile, 2,3,4,5,6-pentachloro- (8CI) ; Mandelonitrile, pentachloro- . |
| Flash Point: | 206.3°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
