| Identification | |
| Name: | Naphthalene,2-(2-methylpropoxy)- |
| Synonyms: | Naphthalene,2-isobutoxy- (7CI,8CI); 2-Isobutoxynaphthalene; Isobutyl 2-naphthyl ether; b-Naphthyl isobutyl ether |
| CAS: | 2173-57-1 |
| EINECS: | 218-529-2 |
| Molecular Formula: | C14H16 O |
| Molecular Weight: | 200.30 |
| InChI: | InChI=1/C14H16O/c1-11(2)10-15-14-8-7-12-5-3-4-6-13(12)9-14/h3-9,11H,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 68 °C |
| Density: | 1.014g/cm3 |
| Refractive index: | 1.568 |
| Specification: |
Naphthalene, 2-(2-methylpropoxy)- ,its cas register number is 2173-57-1. It also can be called 2-Isobutoxynaphthalene ; Isobutyl 2-naphthyl ether ; Naphthalene, 2-isobutoxy- (7CI,8CI) and Ether, isobutyl(2-naphthyl) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 68 °C |
| Safety Data | |
 |
|
