| Identification | |
| Name: | 6-Quinolinemethanol,1,2,3,4-tetrahydro-2-[[(1-methylethyl)amino]methyl]-7-nitro- |
| CAS: | 21738-42-1 |
| EINECS: | 244-556-4 |
| Molecular Formula: | C14H21 N3 O3 |
| Molecular Weight: | 279.38 |
| InChI: | InChI=1/C14H21N3O3/c1-9(2)15-7-12-4-3-10-5-11(8-18)14(17(19)20)6-13(10)16-12/h5-6,9,12,15-16,18H,3-4,7-8H2,1-2H3 |
| Molecular Structure: | ![(C14H21N3O3) 6-Quinolinemethanol,1,2,3,4-tetrahydro-2-[(isopropylamino)methyl]-7-nitro- (8CI); (?à)-Oxamniquine;...](https://img1.guidechem.com/chem/e/dict/20/21738-42-1.jpg) |
| Properties | |
| Melting Point: | 147-149 deg C |
| Flash Point: | 222.1°C |
| Boiling Point: | 443.6°Cat760mmHg |
| Density: | 1.174g/cm3 |
| Refractive index: | 1.56 |
| Solubility: | 1 part in about 3300 parts of water at 27 deg C |
| Specification: |
Oxamniquine ,its cas register number is 21738-42-1. It also can be called 6-Quinolinemethanol, 1,2,3,4-tetrahydro-2-((isopropylamino)methyl)-7-nitro- ; 1,2,3,4-Tetrahydro-2-[(isopropylamino)methyl]-7-nitro-6-quinolinemethanol ; and {2-[(Isopropylamino)methyl]-7-nitro-1,2,3,4-tetrahydro-6-quinolinyl}methanol . It causes worms to shift from the mesenteric veins to the liver where the male worms are retained and is a potent single-dose agent for treatment of Schistosoma mansoni infection in man. It is generally well tolerated following oral doses. Oxamniquine (CAS NO.21738-42-1) is extensively metabolised to inactive metabolites which are excreted in the urine, and is a semisynthetic tetrahydroquinoline and possibly acts by DNA binding resulting in contraction and paralysis of the worms and eventual detachment from terminal venules in the mesentry and death. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 222.1°C |
| Color: | Pale yellow crystals from isopropanol Yellow-orange, crystalline solid |
| Safety Data | |
 |
|
