| Identification |
| Name: | 5-Bromo-2-chlorobenzoic acid |
| Synonyms: | 5-bromo-2-chloro-benzoate;5-bromo-2-chloro-benzoic acid;2-Chloro-5-bromobenzoic acid;5-Bromo-2-Chloro Benzoic Acid;2-Chloro-5-Bromo Benzoic Acid; |
| CAS: | 21739-92-4 |
| EINECS: | 244-558-5 |
| Molecular Formula: | C7H4BrClO2 |
| Molecular Weight: | 235.46 |
| InChI: | InChI=1/C7H4BrClO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.809 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | very soluble in water |
| Solubility: | very soluble in water |
| Appearance: | White to beige powder. |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
